C32H26N2O2 — CID 27600713
(1R,2S,11S,12S)-1,2-dimethoxy-11,12-diphenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-3,5,7,9,13,15,17,19-octaene (PubChem CID 27600713) has the molecular formula C32H26N2O2 and a molecular weight of 470.57 g/mol. Its IUPAC name is (1R,2S,11S,12S)-1,2-dimethoxy-11,12-diphenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-3,5,7,9,13,15,17,19-octaene.
| Compound Name | (1R,2S,11S,12S)-1,2-dimethoxy-11,12-diphenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-3,5,7,9,13,15,17,19-octaene |
|---|---|
| PubChem CID | 27600713 |
| Molecular Formula | C32H26N2O2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (1R,2S,11S,12S)-1,2-dimethoxy-11,12-diphenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-3,5,7,9,13,15,17,19-octaene |
| SMILES | CO[C@]12C(=Nc3ccccc31)[C@H](c1ccccc1)[C@@H](c1ccccc1)C1=Nc3ccccc3[C@@]12OC |
| InChI | InChI=1S/C32H26N2O2/c1-35-31-23-17-9-11-19-25(23)33-29(31)27(21-13-5-3-6-14-21)28(22-15-7-4-8-16-22)30-32(31,36-2)24-18-10-12-20-26(24)34-30/h3-20,27-28H,1-2H3/t27-,28-,31-,32+/m1/s1 |
| InChIKey | CTZSLUNRJXZECL-HIIQBPBGSA-N |
| XLogP | 6.82 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |