C16H23NO2 — CID 56930114
(3R,9S,9aR)-3-ethynyl-9-hydroxy-9a-(2-methylidenebutyl)-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one (PubChem CID 56930114) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (3R,9S,9aR)-3-ethynyl-9-hydroxy-9a-(2-methylidenebutyl)-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one.
| Compound Name | (3R,9S,9aR)-3-ethynyl-9-hydroxy-9a-(2-methylidenebutyl)-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one |
|---|---|
| PubChem CID | 56930114 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (3R,9S,9aR)-3-ethynyl-9-hydroxy-9a-(2-methylidenebutyl)-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one |
| SMILES | C#C[C@H]1CC[C@@]2(CC(=C)CC)[C@@H](O)CCCC(=O)N12 |
| InChI | InChI=1S/C16H23NO2/c1-4-12(3)11-16-10-9-13(5-2)17(16)15(19)8-6-7-14(16)18/h2,13-14,18H,3-4,6-11H2,1H3/t13-,14-,16+/m0/s1 |
| InChIKey | QXTTYPGKTBLZNR-OFQRWUPVSA-N |
| XLogP | 2.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|