C16H22O3 — CID 56930117
2-ethynyl-8a-hydroxy-4a-(2-methylidenebutyl)-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 56930117) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-ethynyl-8a-hydroxy-4a-(2-methylidenebutyl)-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | 2-ethynyl-8a-hydroxy-4a-(2-methylidenebutyl)-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 56930117 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-ethynyl-8a-hydroxy-4a-(2-methylidenebutyl)-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | C#CC1CCC2(CC(=C)CC)C(=O)CCCC2(O)O1 |
| InChI | InChI=1S/C16H22O3/c1-4-12(3)11-15-10-8-13(5-2)19-16(15,18)9-6-7-14(15)17/h2,13,18H,3-4,6-11H2,1H3 |
| InChIKey | QSVRBGQJGRGYHV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|