C21H15ClN2O2S — CID 56933574
N-(1-benzyl-3-oxo-2,1-benzothiazol-5-yl)-2-chlorobenzamide (PubChem CID 56933574) has the molecular formula C21H15ClN2O2S and a molecular weight of 394.88 g/mol. Its IUPAC name is N-(1-benzyl-3-oxo-2,1-benzothiazol-5-yl)-2-chlorobenzamide.
| Compound Name | N-(1-benzyl-3-oxo-2,1-benzothiazol-5-yl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 56933574 |
| Molecular Formula | C21H15ClN2O2S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-(1-benzyl-3-oxo-2,1-benzothiazol-5-yl)-2-chlorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)c(=O)sn2Cc1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C21H15ClN2O2S/c22-18-9-5-4-8-16(18)20(25)23-15-10-11-19-17(12-15)21(26)27-24(19)13-14-6-2-1-3-7-14/h1-12H,13H2,(H,23,25) |
| InChIKey | SJHGSLRKPGEQNB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |