C40H54BrN3O2 — CID 56940776
(1S,2S,6R,7S,9S,12R,13R)-7,9,13-trimethyl-6-[(3R)-3-[4-(2-naphthalen-1-ylethyl)-1,2,4-triazol-4-ium-1-yl]butyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol bromide (PubChem CID 56940776) has the molecular formula C40H54BrN3O2 and a molecular weight of 688.80 g/mol. Its IUPAC name is (1S,2S,6R,7S,9S,12R,13R)-7,9,13-trimethyl-6-[(3R)-3-[4-(2-naphthalen-1-ylethyl)-1,2,4-triazol-4-ium-1-yl]butyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol bromide.
| Compound Name | (1S,2S,6R,7S,9S,12R,13R)-7,9,13-trimethyl-6-[(3R)-3-[4-(2-naphthalen-1-ylethyl)-1,2,4-triazol-4-ium-1-yl]butyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol bromide |
|---|---|
| PubChem CID | 56940776 |
| Molecular Formula | C40H54BrN3O2 |
| Molecular Weight | 688.80 g/mol |
| Exact Mass | 687.34 |
| IUPAC Name | (1S,2S,6R,7S,9S,12R,13R)-7,9,13-trimethyl-6-[(3R)-3-[4-(2-naphthalen-1-ylethyl)-1,2,4-triazol-4-ium-1-yl]butyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol bromide |
| SMILES | CC1C2C(C[C@H]3[C@@H]4CC=C5CC(O)CC[C@]5(C)[C@@H]4CC[C@]23C)O[C@@H]1CC[C@@H](C)n1c[n+](CCc2cccc3ccccc23)cn1.[Br-] |
| InChI | InChI=1S/C40H54N3O2.BrH/c1-26(43-25-42(24-41-43)21-18-29-10-7-9-28-8-5-6-11-32(28)29)12-15-36-27(2)38-37(45-36)23-35-33-14-13-30-22-31(44)16-19-39(30,3)34(33)17-20-40(35,38)4;/h5-11,13,24-27,31,33-38,44H,12,14-23H2,1-4H3;1H/q+1;/p-1/t26-,27?,31?,33-,34-,35+,36-,37?,38?,39+,40+;/m1./s1 |
| InChIKey | GMPKFIKKMVFRRX-JOGMGPKOSA-M |
| XLogP | 4.86 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|