C27H30N4O — CID 56947742
N-[1H-benzimidazol-2-yl-(3-phenylmethoxyphenyl)methyl]-1-methylpiperidin-4-amine (PubChem CID 56947742) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[1H-benzimidazol-2-yl-(3-phenylmethoxyphenyl)methyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[1H-benzimidazol-2-yl-(3-phenylmethoxyphenyl)methyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 56947742 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-[1H-benzimidazol-2-yl-(3-phenylmethoxyphenyl)methyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(NC(c2cccc(OCc3ccccc3)c2)c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C27H30N4O/c1-31-16-14-22(15-17-31)28-26(27-29-24-12-5-6-13-25(24)30-27)21-10-7-11-23(18-21)32-19-20-8-3-2-4-9-20/h2-13,18,22,26,28H,14-17,19H2,1H3,(H,29,30) |
| InChIKey | WPHYIGFFRCYREE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |