C25H32N4O — CID 67512064
N-[1H-benzimidazol-2-yl-(3-pent-4-enoxyphenyl)methyl]-1-methylpiperidin-4-amine (PubChem CID 67512064) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[1H-benzimidazol-2-yl-(3-pent-4-enoxyphenyl)methyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[1H-benzimidazol-2-yl-(3-pent-4-enoxyphenyl)methyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 67512064 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | N-[1H-benzimidazol-2-yl-(3-pent-4-enoxyphenyl)methyl]-1-methylpiperidin-4-amine |
| SMILES | C=CCCCOc1cccc(C(NC2CCN(C)CC2)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C25H32N4O/c1-3-4-7-17-30-21-10-8-9-19(18-21)24(26-20-13-15-29(2)16-14-20)25-27-22-11-5-6-12-23(22)28-25/h3,5-6,8-12,18,20,24,26H,1,4,7,13-17H2,2H3,(H,27,28) |
| InChIKey | ILDZUVBKQFTNBJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|