C10H16ClN5O — CID 56953810
5-[2-(dimethylamino)ethylcarbamoyl]-1-methylpyrrole-3-diazonium chloride (PubChem CID 56953810) has the molecular formula C10H16ClN5O and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylcarbamoyl]-1-methylpyrrole-3-diazonium chloride.
| Compound Name | 5-[2-(dimethylamino)ethylcarbamoyl]-1-methylpyrrole-3-diazonium chloride |
|---|---|
| PubChem CID | 56953810 |
| Molecular Formula | C10H16ClN5O |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-[2-(dimethylamino)ethylcarbamoyl]-1-methylpyrrole-3-diazonium chloride |
| SMILES | CN(C)CCNC(=O)c1cc([N+]#N)cn1C.[Cl-] |
| InChI | InChI=1S/C10H15N5O.ClH/c1-14(2)5-4-12-10(16)9-6-8(13-11)7-15(9)3;/h6-7H,4-5H2,1-3H3;1H |
| InChIKey | XKHUBDPDRQXQGL-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|