C31H58O5Si — CID 56954378
(1S,6S,9R,13R,14S,15S,17R,19S)-14-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one (PubChem CID 56954378) has the molecular formula C31H58O5Si and a molecular weight of 538.89 g/mol. Its IUPAC name is (1S,6S,9R,13R,14S,15S,17R,19S)-14-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one.
| Compound Name | (1S,6S,9R,13R,14S,15S,17R,19S)-14-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one |
|---|---|
| PubChem CID | 56954378 |
| Molecular Formula | C31H58O5Si |
| Molecular Weight | 538.89 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | (1S,6S,9R,13R,14S,15S,17R,19S)-14-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one |
| SMILES | C=C1C[C@@H](CCC)OC(=O)[C@@H](C)CCCC[C@@H]2O[C@H](C[C@@H]2C)C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C1 |
| InChI | InChI=1S/C31H58O5Si/c1-11-14-25-18-21(2)17-24(5)29(36-37(9,10)31(6,7)8)27(32)20-26-19-23(4)28(34-26)16-13-12-15-22(3)30(33)35-25/h22-29,32H,2,11-20H2,1,3-10H3/t22-,23-,24+,25+,26+,27-,28-,29-/m0/s1 |
| InChIKey | MZUMCCJTMDPFDM-VBKPWMSYSA-N |
| XLogP | 7.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.89 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|