C38H24N2O4 — CID 56956594
1-N,4-N-bis(3-phenylchromen-2-ylidene)benzene-1,4-dicarboxamide (PubChem CID 56956594) has the molecular formula C38H24N2O4 and a molecular weight of 572.62 g/mol. Its IUPAC name is 1-N,4-N-bis(3-phenylchromen-2-ylidene)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(3-phenylchromen-2-ylidene)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56956594 |
| Molecular Formula | C38H24N2O4 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 1-N,4-N-bis(3-phenylchromen-2-ylidene)benzene-1,4-dicarboxamide |
| SMILES | O=C(/N=c1\oc2ccccc2cc1-c1ccccc1)c1ccc(C(=O)/N=c2\oc3ccccc3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H24N2O4/c41-35(39-37-31(25-11-3-1-4-12-25)23-29-15-7-9-17-33(29)43-37)27-19-21-28(22-20-27)36(42)40-38-32(26-13-5-2-6-14-26)24-30-16-8-10-18-34(30)44-38/h1-24H/b39-37-,40-38- |
| InChIKey | LJRHXMZCBFIEBQ-YKSAKOAQSA-N |
| XLogP | 8.00 |
| TPSA | 85.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |