C17H28O5 — CID 56957768
methyl (4R,5R)-5-[(E,3R,7S)-3,7-dimethyl-8-oxooct-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 56957768) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl (4R,5R)-5-[(E,3R,7S)-3,7-dimethyl-8-oxooct-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R,5R)-5-[(E,3R,7S)-3,7-dimethyl-8-oxooct-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 56957768 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methyl (4R,5R)-5-[(E,3R,7S)-3,7-dimethyl-8-oxooct-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(C)(C)O[C@@H]1/C=C/[C@H](C)CCC[C@H](C)C=O |
| InChI | InChI=1S/C17H28O5/c1-12(7-6-8-13(2)11-18)9-10-14-15(16(19)20-5)22-17(3,4)21-14/h9-15H,6-8H2,1-5H3/b10-9+/t12-,13+,14-,15-/m1/s1 |
| InChIKey | XQHZRDRYURICAK-GXMWYEJSSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|