C10H16O5S — CID 56958322
S-[(2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyethyl] ethanethioate (PubChem CID 56958322) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is S-[(2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyethyl] ethanethioate.
| Compound Name | S-[(2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyethyl] ethanethioate |
|---|---|
| PubChem CID | 56958322 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | S-[(2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyethyl] ethanethioate |
| SMILES | CC(=O)SC[C@H](O)[C@@H]1OC(C)(C)OCC1=O |
| InChI | InChI=1S/C10H16O5S/c1-6(11)16-5-8(13)9-7(12)4-14-10(2,3)15-9/h8-9,13H,4-5H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | SDSHTSJCQKWXOD-DTWKUNHWSA-N |
| XLogP | 0.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|