C13H20O8 — CID 11623638
diethyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxypropanedioate (PubChem CID 11623638) has the molecular formula C13H20O8 and a molecular weight of 304.30 g/mol. Its IUPAC name is diethyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxypropanedioate.
| Compound Name | diethyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxypropanedioate |
|---|---|
| PubChem CID | 11623638 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | diethyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxypropanedioate |
| SMILES | CCOC(=O)C(O)(C(=O)OCC)[C@@H]1OC(C)(C)OCC1=O |
| InChI | InChI=1S/C13H20O8/c1-5-18-10(15)13(17,11(16)19-6-2)9-8(14)7-20-12(3,4)21-9/h9,17H,5-7H2,1-4H3/t9-/m1/s1 |
| InChIKey | NUERNFKAGZFLEY-SECBINFHSA-N |
| XLogP | -0.44 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|