C14H22O2 — CID 56958895
(3'aR,4S,7'aS)-2,2,3'a-trimethylspiro[1,3-dioxolane-4,3'-2,6,7,7a-tetrahydro-1H-indene] (PubChem CID 56958895) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3'aR,4S,7'aS)-2,2,3'a-trimethylspiro[1,3-dioxolane-4,3'-2,6,7,7a-tetrahydro-1H-indene].
| Compound Name | (3'aR,4S,7'aS)-2,2,3'a-trimethylspiro[1,3-dioxolane-4,3'-2,6,7,7a-tetrahydro-1H-indene] |
|---|---|
| PubChem CID | 56958895 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3'aR,4S,7'aS)-2,2,3'a-trimethylspiro[1,3-dioxolane-4,3'-2,6,7,7a-tetrahydro-1H-indene] |
| SMILES | CC1(C)OC[C@@]2(CC[C@@H]3CCC=C[C@@]32C)O1 |
| InChI | InChI=1S/C14H22O2/c1-12(2)15-10-14(16-12)9-7-11-6-4-5-8-13(11,14)3/h5,8,11H,4,6-7,9-10H2,1-3H3/t11-,13-,14+/m0/s1 |
| InChIKey | XIZHMMPMUZUCIF-FPMFFAJLSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|