C14H22O2 — CID 10977046
(3'aS,5'Z,9'aR)-3'a-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene] (PubChem CID 10977046) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3'aS,5'Z,9'aR)-3'a-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene].
| Compound Name | (3'aS,5'Z,9'aR)-3'a-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene] |
|---|---|
| PubChem CID | 10977046 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3'aS,5'Z,9'aR)-3'a-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene] |
| SMILES | C[C@]12C/C=C\CCC[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C14H22O2/c1-13-8-5-3-2-4-6-12(13)7-9-14(13)15-10-11-16-14/h3,5,12H,2,4,6-11H2,1H3/b5-3-/t12-,13+/m1/s1 |
| InChIKey | CBZJRQKMDMECRT-NZTAEXDXSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|