C17H17F3N4O2 — CID 56959915
[6-(3-methylanilino)-4-(trifluoromethyl)pyridazin-3-yl]-morpholin-4-ylmethanone (PubChem CID 56959915) has the molecular formula C17H17F3N4O2 and a molecular weight of 366.34 g/mol. Its IUPAC name is [6-(3-methylanilino)-4-(trifluoromethyl)pyridazin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(3-methylanilino)-4-(trifluoromethyl)pyridazin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 56959915 |
| Molecular Formula | C17H17F3N4O2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [6-(3-methylanilino)-4-(trifluoromethyl)pyridazin-3-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1cccc(Nc2cc(C(F)(F)F)c(C(=O)N3CCOCC3)nn2)c1 |
| InChI | InChI=1S/C17H17F3N4O2/c1-11-3-2-4-12(9-11)21-14-10-13(17(18,19)20)15(23-22-14)16(25)24-5-7-26-8-6-24/h2-4,9-10H,5-8H2,1H3,(H,21,22) |
| InChIKey | FUFXAECZUOSEOJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |