About [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate
[tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate (PubChem CID 56962378) has the molecular formula C18H26ClNO4
and a molecular weight of 355.86 g/mol. Its IUPAC name is [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate.
Molecular Properties
| Compound Name | [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate |
| PubChem CID | 56962378 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCN(C(C)C(=O)c1cccc(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C18H26ClNO4/c1-12(2)24-17(22)23-11-20(18(4,5)6)13(3)16(21)14-8-7-9-15(19)10-14/h7-10,12-13H,11H2,1-6H3 |
| InChIKey | WYDLNPCJXCBJGS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate?
The IUPAC name of [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate (CID 56962378) is [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate.
What is the SMILES notation for [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate?
The canonical SMILES for [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate is CC(C)OC(=O)OCN(C(C)C(=O)c1cccc(Cl)c1)C(C)(C)C.
What is the InChIKey of [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate?
The InChIKey is WYDLNPCJXCBJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26ClNO4/c1-12(2)24-17(22)23-11-20(18(4,5)6)13(3)16(21)14-8-7-9-15(19)10-14/h7-10,12-13H,11H2,1-6H3.
What are the key properties of [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate?
[tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate has a molecular weight of 355.86 g/mol, XLogP of 4.53, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl-[1-(3-chlorophenyl)-1-oxopropan-2-yl]amino]methyl propan-2-yl carbonate is sourced from PubChem (CID 56962378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).