C26H29N3O4 — CID 56964080
3-[(E)-1-(3,4-dimethoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2-ethylquinazolin-4-one (PubChem CID 56964080) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-[(E)-1-(3,4-dimethoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2-ethylquinazolin-4-one.
| Compound Name | 3-[(E)-1-(3,4-dimethoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 56964080 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-[(E)-1-(3,4-dimethoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2ccccc2c(=O)n1/C(=C/c1ccc(OC)c(OC)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C26H29N3O4/c1-4-24-27-20-11-7-6-10-19(20)25(30)29(24)21(26(31)28-14-8-5-9-15-28)16-18-12-13-22(32-2)23(17-18)33-3/h6-7,10-13,16-17H,4-5,8-9,14-15H2,1-3H3/b21-16+ |
| InChIKey | UGVBLDDYFBLRTG-LTGZKZEYSA-N |
| XLogP | 3.99 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|