C22H31N3O4 — CID 56967622
3-[[(2R)-2-(3,3-dimethylbutanoylamino)-3-(1H-indol-3-yl)propyl]amino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 56967622) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[[(2R)-2-(3,3-dimethylbutanoylamino)-3-(1H-indol-3-yl)propyl]amino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[[(2R)-2-(3,3-dimethylbutanoylamino)-3-(1H-indol-3-yl)propyl]amino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 56967622 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-[[(2R)-2-(3,3-dimethylbutanoylamino)-3-(1H-indol-3-yl)propyl]amino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C)CC(=O)N[C@@H](CNC(=O)C(C)(C)C(=O)O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H31N3O4/c1-21(2,3)11-18(26)25-15(13-24-19(27)22(4,5)20(28)29)10-14-12-23-17-9-7-6-8-16(14)17/h6-9,12,15,23H,10-11,13H2,1-5H3,(H,24,27)(H,25,26)(H,28,29)/t15-/m1/s1 |
| InChIKey | XVWUYHDMMDDTSR-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|