C18H17NO4S — CID 56968615
4-[(4-methylsulfanylphenyl)methoxy]-1-(3-nitrophenyl)but-2-yn-1-ol (PubChem CID 56968615) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-[(4-methylsulfanylphenyl)methoxy]-1-(3-nitrophenyl)but-2-yn-1-ol.
| Compound Name | 4-[(4-methylsulfanylphenyl)methoxy]-1-(3-nitrophenyl)but-2-yn-1-ol |
|---|---|
| PubChem CID | 56968615 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-[(4-methylsulfanylphenyl)methoxy]-1-(3-nitrophenyl)but-2-yn-1-ol |
| SMILES | CSc1ccc(COCC#CC(O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H17NO4S/c1-24-17-9-7-14(8-10-17)13-23-11-3-6-18(20)15-4-2-5-16(12-15)19(21)22/h2,4-5,7-10,12,18,20H,11,13H2,1H3 |
| InChIKey | UXAFZMDWBSYVLT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|