C35H64O4Si2 — CID 56969670
ethyl (3R,4R)-4-methyl-6-methylidene-16-phenyl-4-triethylsilyloxy-3-trimethylsilyloxyhexadecanoate (PubChem CID 56969670) has the molecular formula C35H64O4Si2 and a molecular weight of 605.07 g/mol. Its IUPAC name is ethyl (3R,4R)-4-methyl-6-methylidene-16-phenyl-4-triethylsilyloxy-3-trimethylsilyloxyhexadecanoate.
| Compound Name | ethyl (3R,4R)-4-methyl-6-methylidene-16-phenyl-4-triethylsilyloxy-3-trimethylsilyloxyhexadecanoate |
|---|---|
| PubChem CID | 56969670 |
| Molecular Formula | C35H64O4Si2 |
| Molecular Weight | 605.07 g/mol |
| Exact Mass | 604.43 |
| IUPAC Name | ethyl (3R,4R)-4-methyl-6-methylidene-16-phenyl-4-triethylsilyloxy-3-trimethylsilyloxyhexadecanoate |
| SMILES | C=C(CCCCCCCCCCc1ccccc1)C[C@@](C)(O[Si](CC)(CC)CC)[C@@H](CC(=O)OCC)O[Si](C)(C)C |
| InChI | InChI=1S/C35H64O4Si2/c1-10-37-34(36)29-33(38-40(7,8)9)35(6,39-41(11-2,12-3)13-4)30-31(5)25-21-18-16-14-15-17-19-22-26-32-27-23-20-24-28-32/h20,23-24,27-28,33H,5,10-19,21-22,25-26,29-30H2,1-4,6-9H3/t33-,35-/m1/s1 |
| InChIKey | LUNGNCGCIBBQEN-VLZNPVHKSA-N |
| XLogP | 10.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.07 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|