C24H34N2O3 — CID 58929441
ethyl (4S)-4-(7-phenylheptanoylamino)-5-(3H-pyrrol-5-yl)pentanoate (PubChem CID 58929441) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl (4S)-4-(7-phenylheptanoylamino)-5-(3H-pyrrol-5-yl)pentanoate.
| Compound Name | ethyl (4S)-4-(7-phenylheptanoylamino)-5-(3H-pyrrol-5-yl)pentanoate |
|---|---|
| PubChem CID | 58929441 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | ethyl (4S)-4-(7-phenylheptanoylamino)-5-(3H-pyrrol-5-yl)pentanoate |
| SMILES | CCOC(=O)CC[C@@H](CC1=CCC=N1)NC(=O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C24H34N2O3/c1-2-29-24(28)17-16-22(19-21-14-10-18-25-21)26-23(27)15-9-4-3-6-11-20-12-7-5-8-13-20/h5,7-8,12-14,18,22H,2-4,6,9-11,15-17,19H2,1H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | INAONYBLZZQWIR-QFIPXVFZSA-N |
| XLogP | 4.76 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|