C31H32N4O4 — CID 56974365
3-[4-amino-3-[2-(dimethylamino)ethoxy]phenyl]-1-[1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]prop-2-en-1-one (PubChem CID 56974365) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is 3-[4-amino-3-[2-(dimethylamino)ethoxy]phenyl]-1-[1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]prop-2-en-1-one.
| Compound Name | 3-[4-amino-3-[2-(dimethylamino)ethoxy]phenyl]-1-[1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56974365 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 3-[4-amino-3-[2-(dimethylamino)ethoxy]phenyl]-1-[1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]prop-2-en-1-one |
| SMILES | CN(C)CCOc1cc(C=CC(=O)C2Cc3c([nH]c4ccccc34)C(c3ccc4c(c3)OCO4)N2)ccc1N |
| InChI | InChI=1S/C31H32N4O4/c1-35(2)13-14-37-28-15-19(7-10-23(28)32)8-11-26(36)25-17-22-21-5-3-4-6-24(21)33-31(22)30(34-25)20-9-12-27-29(16-20)39-18-38-27/h3-12,15-16,25,30,33-34H,13-14,17-18,32H2,1-2H3 |
| InChIKey | IKIBGSDJIPWRAG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|