C12H22O3 — CID 56974379
(2S,3S)-3-[(2S,3S)-3-[[(3S)-oxan-3-yl]methyl]oxiran-2-yl]butan-2-ol (PubChem CID 56974379) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (2S,3S)-3-[(2S,3S)-3-[[(3S)-oxan-3-yl]methyl]oxiran-2-yl]butan-2-ol.
| Compound Name | (2S,3S)-3-[(2S,3S)-3-[[(3S)-oxan-3-yl]methyl]oxiran-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 56974379 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2S,3S)-3-[(2S,3S)-3-[[(3S)-oxan-3-yl]methyl]oxiran-2-yl]butan-2-ol |
| SMILES | C[C@H]([C@@H]1O[C@H]1C[C@@H]1CCCOC1)[C@H](C)O |
| InChI | InChI=1S/C12H22O3/c1-8(9(2)13)12-11(15-12)6-10-4-3-5-14-7-10/h8-13H,3-7H2,1-2H3/t8-,9-,10-,11-,12-/m0/s1 |
| InChIKey | IBKACMAXMAHYSL-HTFCKZLJSA-N |
| XLogP | 1.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|