C10H13N — CID 56976839
3-azabicyclo[5.3.1]undeca-2,7,9-triene (PubChem CID 56976839) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 3-azabicyclo[5.3.1]undeca-2,7,9-triene.
| Compound Name | 3-azabicyclo[5.3.1]undeca-2,7,9-triene |
|---|---|
| PubChem CID | 56976839 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3-azabicyclo[5.3.1]undeca-2,7,9-triene |
| SMILES | C1=CC2/C=N\CCCC(=C1)C2 |
| InChI | InChI=1S/C10H13N/c1-3-9-5-2-6-11-8-10(4-1)7-9/h1,3-4,8,10H,2,5-7H2/b11-8- |
| InChIKey | XKCKOXPGUCMGCP-FLIBITNWSA-N |
| XLogP | 2.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |