C15H17N — CID 91186536
1,2,5,6,6a,12a-hexahydrobenzo[i][3]benzazocine (PubChem CID 91186536) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is 1,2,5,6,6a,12a-hexahydrobenzo[i][3]benzazocine.
| Compound Name | 1,2,5,6,6a,12a-hexahydrobenzo[i][3]benzazocine |
|---|---|
| PubChem CID | 91186536 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1,2,5,6,6a,12a-hexahydrobenzo[i][3]benzazocine |
| SMILES | C1=c2ccccc2=CC2CC/N=C\CCC12 |
| InChI | InChI=1S/C15H17N/c1-2-5-13-11-15-7-9-16-8-3-6-14(15)10-12(13)4-1/h1-2,4-5,8,10-11,14-15H,3,6-7,9H2/b16-8- |
| InChIKey | QBGIANCQKJYRHU-PXNMLYILSA-N |
| XLogP | 1.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |