C11H15N — CID 91329462
1,4,5,6,6a,10a-hexahydro-2-benzazocine (PubChem CID 91329462) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,4,5,6,6a,10a-hexahydro-2-benzazocine.
| Compound Name | 1,4,5,6,6a,10a-hexahydro-2-benzazocine |
|---|---|
| PubChem CID | 91329462 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1,4,5,6,6a,10a-hexahydro-2-benzazocine |
| SMILES | C1=CC2CCC/C=N\CC2C=C1 |
| InChI | InChI=1S/C11H15N/c1-2-7-11-9-12-8-4-3-6-10(11)5-1/h1-2,5,7-8,10-11H,3-4,6,9H2/b12-8- |
| InChIKey | MTMRVICSPQFYQN-WQLSENKSSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |