C21H28BrFO4 — CID 56977536
(8S,9S,10R,13S,14S,17S)-7-bromo-6-fluoro-1-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 56977536) has the molecular formula C21H28BrFO4 and a molecular weight of 443.35 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-7-bromo-6-fluoro-1-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-7-bromo-6-fluoro-1-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56977536 |
| Molecular Formula | C21H28BrFO4 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-7-bromo-6-fluoro-1-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](C(Br)C(F)C4=CC(=O)CC(O)[C@@]43C)[C@@H]1CC[C@@H]2C(=O)CO |
| InChI | InChI=1S/C21H28BrFO4/c1-20-6-5-13-17(12(20)4-3-11(20)15(26)9-24)18(22)19(23)14-7-10(25)8-16(27)21(13,14)2/h7,11-13,16-19,24,27H,3-6,8-9H2,1-2H3/t11-,12+,13+,16?,17+,18?,19?,20-,21-/m1/s1 |
| InChIKey | DOUKXIAGSLGKEY-HQSCBVJUSA-N |
| XLogP | 2.99 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|