C26H42O6 — CID 56978500
4-[7-[(1R,2S)-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptoxy]-4-oxobutanoic acid (PubChem CID 56978500) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is 4-[7-[(1R,2S)-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptoxy]-4-oxobutanoic acid.
| Compound Name | 4-[7-[(1R,2S)-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 56978500 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 4-[7-[(1R,2S)-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptoxy]-4-oxobutanoic acid |
| SMILES | CCCCC(C)(C)[C@H](O)C=C[C@H]1C=CC(=O)[C@@H]1CCCCCCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C26H42O6/c1-4-5-18-26(2,3)23(28)15-13-20-12-14-22(27)21(20)11-9-7-6-8-10-19-32-25(31)17-16-24(29)30/h12-15,20-21,23,28H,4-11,16-19H2,1-3H3,(H,29,30)/t20-,21-,23-/m1/s1 |
| InChIKey | OSJLSZTYKLTTCI-MQSCRBSSSA-N |
| XLogP | 5.24 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|