About (2-methylimidazol-1-yl) 2-methoxybenzoate
(2-methylimidazol-1-yl) 2-methoxybenzoate (PubChem CID 56979486) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is (2-methylimidazol-1-yl) 2-methoxybenzoate.
Molecular Properties
| Compound Name | (2-methylimidazol-1-yl) 2-methoxybenzoate |
| PubChem CID | 56979486 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (2-methylimidazol-1-yl) 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)On1ccnc1C |
| InChI | InChI=1S/C12H12N2O3/c1-9-13-7-8-14(9)17-12(15)10-5-3-4-6-11(10)16-2/h3-8H,1-2H3 |
| InChIKey | HGHCEPOBDPOIPF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methylimidazol-1-yl) 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylimidazol-1-yl) 2-methoxybenzoate?
The IUPAC name of (2-methylimidazol-1-yl) 2-methoxybenzoate (CID 56979486) is (2-methylimidazol-1-yl) 2-methoxybenzoate.
What is the SMILES notation for (2-methylimidazol-1-yl) 2-methoxybenzoate?
The canonical SMILES for (2-methylimidazol-1-yl) 2-methoxybenzoate is COc1ccccc1C(=O)On1ccnc1C.
What is the InChIKey of (2-methylimidazol-1-yl) 2-methoxybenzoate?
The InChIKey is HGHCEPOBDPOIPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-9-13-7-8-14(9)17-12(15)10-5-3-4-6-11(10)16-2/h3-8H,1-2H3.
What are the key properties of (2-methylimidazol-1-yl) 2-methoxybenzoate?
(2-methylimidazol-1-yl) 2-methoxybenzoate has a molecular weight of 232.24 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylimidazol-1-yl) 2-methoxybenzoate is sourced from PubChem (CID 56979486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).