C26H40N2O2 — CID 56981436
(2S)-N,N-diethyl-2-[(8S,9S,10R,13S,14S,17R)-4-imino-10,13-dimethyl-3-oxo-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanamide (PubChem CID 56981436) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is (2S)-N,N-diethyl-2-[(8S,9S,10R,13S,14S,17R)-4-imino-10,13-dimethyl-3-oxo-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanamide.
| Compound Name | (2S)-N,N-diethyl-2-[(8S,9S,10R,13S,14S,17R)-4-imino-10,13-dimethyl-3-oxo-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanamide |
|---|---|
| PubChem CID | 56981436 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | (2S)-N,N-diethyl-2-[(8S,9S,10R,13S,14S,17R)-4-imino-10,13-dimethyl-3-oxo-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanamide |
| SMILES | [H]/N=C1\C(=O)CC[C@@]2(C)C1C=C[C@H]1[C@@H]3CC[C@H]([C@H](C)C(=O)N(CC)CC)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C26H40N2O2/c1-6-28(7-2)24(30)16(3)18-10-11-19-17-8-9-21-23(27)22(29)13-15-26(21,5)20(17)12-14-25(18,19)4/h8-9,16-21,27H,6-7,10-15H2,1-5H3/b27-23-/t16-,17-,18+,19-,20-,21?,25+,26+/m0/s1 |
| InChIKey | DOZKORWTSVSOIH-REPBYDQZSA-N |
| XLogP | 5.12 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|