C21H31NO3 — CID 57122597
(8R,9S,10R,13S,14S,17S)-17-[(1R)-1,2-dihydroxyethyl]-4-imino-10,13-dimethyl-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57122597) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-17-[(1R)-1,2-dihydroxyethyl]-4-imino-10,13-dimethyl-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-17-[(1R)-1,2-dihydroxyethyl]-4-imino-10,13-dimethyl-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57122597 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-[(1R)-1,2-dihydroxyethyl]-4-imino-10,13-dimethyl-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | [H]/N=C1\C(=O)CC[C@@]2(C)C1C=C[C@H]1[C@@H]3CC[C@H]([C@@H](O)CO)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H31NO3/c1-20-9-7-14-12(13(20)5-6-15(20)18(25)11-23)3-4-16-19(22)17(24)8-10-21(14,16)2/h3-4,12-16,18,22-23,25H,5-11H2,1-2H3/b22-19-/t12-,13-,14-,15+,16?,18-,20-,21+/m0/s1 |
| InChIKey | KFHAOVRYYSDZML-GNBPTBMASA-N |
| XLogP | 2.97 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|