C10H12N2OS — CID 56986971
3-(4-methylphenyl)sulfanyl-1,2-oxazolidin-4-imine (PubChem CID 56986971) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfanyl-1,2-oxazolidin-4-imine.
| Compound Name | 3-(4-methylphenyl)sulfanyl-1,2-oxazolidin-4-imine |
|---|---|
| PubChem CID | 56986971 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-(4-methylphenyl)sulfanyl-1,2-oxazolidin-4-imine |
| SMILES | [H]/N=C1\CONC1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C10H12N2OS/c1-7-2-4-8(5-3-7)14-10-9(11)6-13-12-10/h2-5,10-12H,6H2,1H3/b11-9+ |
| InChIKey | OBQFJMKEQZSCSO-PKNBQFBNSA-N |
| XLogP | 1.97 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|