C18H26N4O — CID 56989201
N'-(3-methylphenyl)-N-(1-methylpiperidin-2-ylidene)morpholine-4-carboximidamide (PubChem CID 56989201) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is N'-(3-methylphenyl)-N-(1-methylpiperidin-2-ylidene)morpholine-4-carboximidamide.
| Compound Name | N'-(3-methylphenyl)-N-(1-methylpiperidin-2-ylidene)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 56989201 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N'-(3-methylphenyl)-N-(1-methylpiperidin-2-ylidene)morpholine-4-carboximidamide |
| SMILES | Cc1cccc(/N=C(/N=C2CCCCN2C)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H26N4O/c1-15-6-5-7-16(14-15)19-18(22-10-12-23-13-11-22)20-17-8-3-4-9-21(17)2/h5-7,14H,3-4,8-13H2,1-2H3/b19-18-,20-17? |
| InChIKey | PRDPGEYWYKGASD-PJGOZTFSSA-N |
| XLogP | 2.83 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|