C19H28N4 — CID 70594748
1-cyclopentyl-1-methyl-2-(3-methylphenyl)-3-(1-methylpyrrolidin-2-ylidene)guanidine (PubChem CID 70594748) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-cyclopentyl-1-methyl-2-(3-methylphenyl)-3-(1-methylpyrrolidin-2-ylidene)guanidine.
| Compound Name | 1-cyclopentyl-1-methyl-2-(3-methylphenyl)-3-(1-methylpyrrolidin-2-ylidene)guanidine |
|---|---|
| PubChem CID | 70594748 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 1-cyclopentyl-1-methyl-2-(3-methylphenyl)-3-(1-methylpyrrolidin-2-ylidene)guanidine |
| SMILES | Cc1cccc(/N=C(\N=C2CCCN2C)N(C)C2CCCC2)c1 |
| InChI | InChI=1S/C19H28N4/c1-15-8-6-9-16(14-15)20-19(21-18-12-7-13-22(18)2)23(3)17-10-4-5-11-17/h6,8-9,14,17H,4-5,7,10-13H2,1-3H3/b20-19+,21-18? |
| InChIKey | XUQBRBLOTQJUCS-NFMTULRYSA-N |
| XLogP | 3.98 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|