C19H20ClNO2 — CID 56989680
1-[(10-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol (PubChem CID 56989680) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 1-[(10-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol.
| Compound Name | 1-[(10-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 56989680 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[(10-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol |
| SMILES | CC(CO)C(O)NCc1c2ccccc2c(Cl)c2ccccc12 |
| InChI | InChI=1S/C19H20ClNO2/c1-12(11-22)19(23)21-10-17-13-6-2-4-8-15(13)18(20)16-9-5-3-7-14(16)17/h2-9,12,19,21-23H,10-11H2,1H3 |
| InChIKey | UUJSNDFZOJMLLH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|