C27H50O4Si — CID 56990915
2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-2-[(3S)-3-methyloctyl]-5-oxocyclopent-2-en-1-yl]heptanoic acid (PubChem CID 56990915) has the molecular formula C27H50O4Si and a molecular weight of 466.78 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-2-[(3S)-3-methyloctyl]-5-oxocyclopent-2-en-1-yl]heptanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-2-[(3S)-3-methyloctyl]-5-oxocyclopent-2-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 56990915 |
| Molecular Formula | C27H50O4Si |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-2-[(3S)-3-methyloctyl]-5-oxocyclopent-2-en-1-yl]heptanoic acid |
| SMILES | CCCCC[C@H](C)CCC1=CCC(=O)[C@@H]1CCCCCC(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C27H50O4Si/c1-8-9-11-14-21(2)17-18-22-19-20-24(28)23(22)15-12-10-13-16-25(26(29)30)31-32(6,7)27(3,4)5/h19,21,23,25H,8-18,20H2,1-7H3,(H,29,30)/t21-,23+,25?/m0/s1 |
| InChIKey | YXJJFBZNJQTCGB-RSVYQVDKSA-N |
| XLogP | 7.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|