C26H41F3O4Si — CID 57178592
2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-5-oxo-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 57178592) has the molecular formula C26H41F3O4Si and a molecular weight of 502.69 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-5-oxo-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-5-oxo-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 57178592 |
| Molecular Formula | C26H41F3O4Si |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-5-oxo-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(C=C=CCC[C@H]1C(=O)CC=C1CCCCCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C26H41F3O4Si/c1-25(2,3)34(4,5)33-23(24(31)32)16-12-9-11-15-21-20(17-18-22(21)30)14-10-7-6-8-13-19-26(27,28)29/h9,16-17,21,23H,6-8,10-11,13-15,18-19H2,1-5H3,(H,31,32)/t12?,21-,23?/m1/s1 |
| InChIKey | PMGHQDCMKISQIE-QQLUZXNBSA-N |
| XLogP | 7.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|