C32H57F3O4Si2 — CID 54491613
2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-5-triethylsilyloxy-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 54491613) has the molecular formula C32H57F3O4Si2 and a molecular weight of 618.97 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-5-triethylsilyloxy-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-5-triethylsilyloxy-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 54491613 |
| Molecular Formula | C32H57F3O4Si2 |
| Molecular Weight | 618.97 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-5-triethylsilyloxy-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CC[Si](CC)(CC)OC1CC=C(CCCCCCCC(F)(F)F)[C@H]1CCC=C=CC(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C32H57F3O4Si2/c1-9-41(10-2,11-3)39-28-24-23-26(20-16-13-12-14-19-25-32(33,34)35)27(28)21-17-15-18-22-29(30(36)37)38-40(7,8)31(4,5)6/h15,22-23,27-29H,9-14,16-17,19-21,24-25H2,1-8H3,(H,36,37)/t18?,27-,28?,29?/m1/s1 |
| InChIKey | XWCTVOQZCDDDIG-UMSJVYRISA-N |
| XLogP | 10.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.97 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|