C34H64O4Si2 — CID 18636884
7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18636884) has the molecular formula C34H64O4Si2 and a molecular weight of 593.05 g/mol. Its IUPAC name is 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18636884 |
| Molecular Formula | C34H64O4Si2 |
| Molecular Weight | 593.05 g/mol |
| Exact Mass | 592.43 |
| IUPAC Name | 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-5-triethylsilyloxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCCC(C)C(CCC1=CC[C@H](O[Si](CC)(CC)CC)[C@@H]1CCC=C=CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H64O4Si2/c1-11-15-18-21-28(5)31(37-39(9,10)34(6,7)8)26-24-29-25-27-32(38-40(12-2,13-3)14-4)30(29)22-19-16-17-20-23-33(35)36/h16,20,25,28,30-32H,11-15,18-19,21-24,26-27H2,1-10H3,(H,35,36)/t17?,28?,30-,31?,32+/m1/s1 |
| InChIKey | SSJQRVICORTZRK-NLOKROKJSA-N |
| XLogP | 10.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.05 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|