C20H27F3O4 — CID 57132515
2-hydroxy-7-[(1R)-5-oxo-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 57132515) has the molecular formula C20H27F3O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R)-5-oxo-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 2-hydroxy-7-[(1R)-5-oxo-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 57132515 |
| Molecular Formula | C20H27F3O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-hydroxy-7-[(1R)-5-oxo-2-(8,8,8-trifluorooctyl)cyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | O=C(O)C(O)C=C=CCC[C@H]1C(=O)CC=C1CCCCCCCC(F)(F)F |
| InChI | InChI=1S/C20H27F3O4/c21-20(22,23)14-8-3-1-2-5-9-15-12-13-17(24)16(15)10-6-4-7-11-18(25)19(26)27/h4,11-12,16,18,25H,1-3,5-6,8-10,13-14H2,(H,26,27)/t7?,16-,18?/m1/s1 |
| InChIKey | IYQPOOQLONIDIQ-IXKPDNBKSA-N |
| XLogP | 4.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|