C21H32O4 — CID 54112093
7-[(1R)-5-formyl-2-octylcyclopent-2-en-1-yl]-2-hydroxyhepta-3,4-dienoic acid (PubChem CID 54112093) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 7-[(1R)-5-formyl-2-octylcyclopent-2-en-1-yl]-2-hydroxyhepta-3,4-dienoic acid.
| Compound Name | 7-[(1R)-5-formyl-2-octylcyclopent-2-en-1-yl]-2-hydroxyhepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 54112093 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 7-[(1R)-5-formyl-2-octylcyclopent-2-en-1-yl]-2-hydroxyhepta-3,4-dienoic acid |
| SMILES | CCCCCCCCC1=CCC(C=O)[C@H]1CCC=C=CC(O)C(=O)O |
| InChI | InChI=1S/C21H32O4/c1-2-3-4-5-6-8-11-17-14-15-18(16-22)19(17)12-9-7-10-13-20(23)21(24)25/h7,13-14,16,18-20,23H,2-6,8-9,11-12,15H2,1H3,(H,24,25)/t10?,18?,19-,20?/m0/s1 |
| InChIKey | NHVDDTWAXVNTSG-UBCSGJSYSA-N |
| XLogP | 4.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|