C26H48O4Si — CID 57059849
2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-2-octyl-5-oxocyclopent-2-en-1-yl]heptanoic acid (PubChem CID 57059849) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-2-octyl-5-oxocyclopent-2-en-1-yl]heptanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-2-octyl-5-oxocyclopent-2-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57059849 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R)-2-octyl-5-oxocyclopent-2-en-1-yl]heptanoic acid |
| SMILES | CCCCCCCCC1=CCC(=O)[C@@H]1CCCCCC(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C26H48O4Si/c1-7-8-9-10-11-13-16-21-19-20-23(27)22(21)17-14-12-15-18-24(25(28)29)30-31(5,6)26(2,3)4/h19,22,24H,7-18,20H2,1-6H3,(H,28,29)/t22-,24?/m1/s1 |
| InChIKey | MZGODCCIHFDWHC-LETIRJCYSA-N |
| XLogP | 7.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|