C27H46O4Si — CID 57049493
2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-5-formyl-2-octylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 57049493) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-5-formyl-2-octylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-5-formyl-2-octylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 57049493 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,5S)-5-formyl-2-octylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCCCCCC1=CC[C@H](C=O)[C@H]1CCC=C=CC(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C27H46O4Si/c1-7-8-9-10-11-13-16-22-19-20-23(21-28)24(22)17-14-12-15-18-25(26(29)30)31-32(5,6)27(2,3)4/h12,18-19,21,23-25H,7-11,13-14,16-17,20H2,1-6H3,(H,29,30)/t15?,23-,24+,25?/m1/s1 |
| InChIKey | JFMLHQZMVLAQDQ-SDFBGSAISA-N |
| XLogP | 7.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|