C26H48O3Si — CID 20596651
2-[tert-butyl(dimethyl)silyl]oxy-7-[(5R)-5-[(E)-oct-1-enyl]cyclopenten-1-yl]heptanoic acid (PubChem CID 20596651) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-[(5R)-5-[(E)-oct-1-enyl]cyclopenten-1-yl]heptanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(5R)-5-[(E)-oct-1-enyl]cyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 20596651 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-[(5R)-5-[(E)-oct-1-enyl]cyclopenten-1-yl]heptanoic acid |
| SMILES | CCCCCC/C=C/[C@H]1CCC=C1CCCCCC(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C26H48O3Si/c1-7-8-9-10-11-13-17-22-19-16-20-23(22)18-14-12-15-21-24(25(27)28)29-30(5,6)26(2,3)4/h13,17,20,22,24H,7-12,14-16,18-19,21H2,1-6H3,(H,27,28)/b17-13+/t22-,24?/m0/s1 |
| InChIKey | RFEWWOFEZNNREV-CIIGGCMJSA-N |
| XLogP | 8.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|