C19H36O3Si2 — CID 56993888
tert-butyl-[4-(methoxymethoxy)-4-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-yl]oxy-dimethylsilane (PubChem CID 56993888) has the molecular formula C19H36O3Si2 and a molecular weight of 368.67 g/mol. Its IUPAC name is tert-butyl-[4-(methoxymethoxy)-4-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[4-(methoxymethoxy)-4-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 56993888 |
| Molecular Formula | C19H36O3Si2 |
| Molecular Weight | 368.67 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | tert-butyl-[4-(methoxymethoxy)-4-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-yl]oxy-dimethylsilane |
| SMILES | COCOC1(CC#C[Si](C)(C)C)C=CC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H36O3Si2/c1-18(2,3)24(8,9)22-17-11-13-19(15-17,21-16-20-4)12-10-14-23(5,6)7/h11,13,17H,12,15-16H2,1-9H3 |
| InChIKey | LYTDUEBSXHZJTO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|