C28H56O3Si3 — CID 11678087
tert-butyl-dimethyl-[(Z,1S)-1-[(E,3S)-2-methyl-3-(2-trimethylsilylethoxymethoxy)hex-4-en-2-yl]-6-trimethylsilylhex-3-en-5-ynoxy]silane (PubChem CID 11678087) has the molecular formula C28H56O3Si3 and a molecular weight of 525.01 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,1S)-1-[(E,3S)-2-methyl-3-(2-trimethylsilylethoxymethoxy)hex-4-en-2-yl]-6-trimethylsilylhex-3-en-5-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z,1S)-1-[(E,3S)-2-methyl-3-(2-trimethylsilylethoxymethoxy)hex-4-en-2-yl]-6-trimethylsilylhex-3-en-5-ynoxy]silane |
|---|---|
| PubChem CID | 11678087 |
| Molecular Formula | C28H56O3Si3 |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,1S)-1-[(E,3S)-2-methyl-3-(2-trimethylsilylethoxymethoxy)hex-4-en-2-yl]-6-trimethylsilylhex-3-en-5-ynoxy]silane |
| SMILES | C/C=C/[C@H](OCOCC[Si](C)(C)C)C(C)(C)[C@H](C/C=C\C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O3Si3/c1-15-19-25(30-24-29-21-23-33(10,11)12)28(5,6)26(31-34(13,14)27(2,3)4)20-17-16-18-22-32(7,8)9/h15-17,19,25-26H,20-21,23-24H2,1-14H3/b17-16-,19-15+/t25-,26-/m0/s1 |
| InChIKey | SZPZDEBTHOWRPG-HFTWUANCSA-N |
| XLogP | 8.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|