C23H47IO3Si2 — CID 11295871
tert-butyl-[(E,1S,3S)-1-[(Z)-3-iodoprop-2-enyl]-2,2-dimethyl-3-(2-trimethylsilylethoxymethoxy)hex-4-enoxy]-dimethylsilane (PubChem CID 11295871) has the molecular formula C23H47IO3Si2 and a molecular weight of 554.70 g/mol. Its IUPAC name is tert-butyl-[(E,1S,3S)-1-[(Z)-3-iodoprop-2-enyl]-2,2-dimethyl-3-(2-trimethylsilylethoxymethoxy)hex-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S,3S)-1-[(Z)-3-iodoprop-2-enyl]-2,2-dimethyl-3-(2-trimethylsilylethoxymethoxy)hex-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11295871 |
| Molecular Formula | C23H47IO3Si2 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | tert-butyl-[(E,1S,3S)-1-[(Z)-3-iodoprop-2-enyl]-2,2-dimethyl-3-(2-trimethylsilylethoxymethoxy)hex-4-enoxy]-dimethylsilane |
| SMILES | C/C=C/[C@H](OCOCC[Si](C)(C)C)C(C)(C)[C@H](C/C=C\I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H47IO3Si2/c1-12-14-20(26-19-25-17-18-28(7,8)9)23(5,6)21(15-13-16-24)27-29(10,11)22(2,3)4/h12-14,16,20-21H,15,17-19H2,1-11H3/b14-12+,16-13-/t20-,21-/m0/s1 |
| InChIKey | KMVJQUOUHBKDMB-RZLGWGGISA-N |
| XLogP | 8.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|