C16H32O3Si — CID 57024402
tert-butyl-[3-ethyl-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl]oxy-dimethylsilane (PubChem CID 57024402) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is tert-butyl-[3-ethyl-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[3-ethyl-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 57024402 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | tert-butyl-[3-ethyl-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl]oxy-dimethylsilane |
| SMILES | CCC1=CC(O[Si](C)(C)C(C)(C)C)CC1(C)OCOC |
| InChI | InChI=1S/C16H32O3Si/c1-9-13-10-14(11-16(13,5)18-12-17-6)19-20(7,8)15(2,3)4/h10,14H,9,11-12H2,1-8H3 |
| InChIKey | XJXJOLKTXPKFDZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|