C16H35O2PS2 — CID 56996091
bis(2,4-dimethylhexoxy)-sulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 56996091) has the molecular formula C16H35O2PS2 and a molecular weight of 354.56 g/mol. Its IUPAC name is bis(2,4-dimethylhexoxy)-sulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | bis(2,4-dimethylhexoxy)-sulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 56996091 |
| Molecular Formula | C16H35O2PS2 |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | bis(2,4-dimethylhexoxy)-sulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCC(C)CC(C)COP(=S)(S)OCC(C)CC(C)CC |
| InChI | InChI=1S/C16H35O2PS2/c1-7-13(3)9-15(5)11-17-19(20,21)18-12-16(6)10-14(4)8-2/h13-16H,7-12H2,1-6H3,(H,20,21) |
| InChIKey | LMMGIWKTKMPJAD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|